C20H19N3O5S — CID 110529316
[4-(4,5-dimethoxy-2-nitrophenyl)-6-methyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidin-5-yl]-phenylmethanone (PubChem CID 110529316) has the molecular formula C20H19N3O5S and a molecular weight of 413.46 g/mol. Its IUPAC name is [4-(4,5-dimethoxy-2-nitrophenyl)-6-methyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidin-5-yl]-phenylmethanone.
| Compound Name | [4-(4,5-dimethoxy-2-nitrophenyl)-6-methyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidin-5-yl]-phenylmethanone |
|---|---|
| PubChem CID | 110529316 |
| Molecular Formula | C20H19N3O5S |
| Molecular Weight | 413.46 g/mol |
| Exact Mass | 413.10 |
| IUPAC Name | [4-(4,5-dimethoxy-2-nitrophenyl)-6-methyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidin-5-yl]-phenylmethanone |
| SMILES | COc1cc(C2NC(=S)NC(C)=C2C(=O)c2ccccc2)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C20H19N3O5S/c1-11-17(19(24)12-7-5-4-6-8-12)18(22-20(29)21-11)13-9-15(27-2)16(28-3)10-14(13)23(25)26/h4-10,18H,1-3H3,(H2,21,22,29) |
| InChIKey | XUXIZGSLQZLINO-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 102.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.46 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|