C21H19N3O6S — CID 110529671
[4-(5-acetyl-6-methyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidin-4-yl)-2-methoxyphenyl] 3-nitrobenzoate (PubChem CID 110529671) has the molecular formula C21H19N3O6S and a molecular weight of 441.47 g/mol. Its IUPAC name is [4-(5-acetyl-6-methyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidin-4-yl)-2-methoxyphenyl] 3-nitrobenzoate.
| Compound Name | [4-(5-acetyl-6-methyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidin-4-yl)-2-methoxyphenyl] 3-nitrobenzoate |
|---|---|
| PubChem CID | 110529671 |
| Molecular Formula | C21H19N3O6S |
| Molecular Weight | 441.47 g/mol |
| Exact Mass | 441.10 |
| IUPAC Name | [4-(5-acetyl-6-methyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidin-4-yl)-2-methoxyphenyl] 3-nitrobenzoate |
| SMILES | COc1cc(C2NC(=S)NC(C)=C2C(C)=O)ccc1OC(=O)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C21H19N3O6S/c1-11-18(12(2)25)19(23-21(31)22-11)13-7-8-16(17(10-13)29-3)30-20(26)14-5-4-6-15(9-14)24(27)28/h4-10,19H,1-3H3,(H2,22,23,31) |
| InChIKey | SVDJUAWVJAOEER-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 119.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.47 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|