C25H27N3O8 — CID 110847463
ethyl 6-butyl-4-[3-methoxy-4-(3-nitrobenzoyl)oxyphenyl]-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate (PubChem CID 110847463) has the molecular formula C25H27N3O8 and a molecular weight of 497.50 g/mol. Its IUPAC name is ethyl 6-butyl-4-[3-methoxy-4-(3-nitrobenzoyl)oxyphenyl]-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate.
| Compound Name | ethyl 6-butyl-4-[3-methoxy-4-(3-nitrobenzoyl)oxyphenyl]-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 110847463 |
| Molecular Formula | C25H27N3O8 |
| Molecular Weight | 497.50 g/mol |
| Exact Mass | 497.18 |
| IUPAC Name | ethyl 6-butyl-4-[3-methoxy-4-(3-nitrobenzoyl)oxyphenyl]-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate |
| SMILES | CCCCC1=C(C(=O)OCC)C(c2ccc(OC(=O)c3cccc([N+](=O)[O-])c3)c(OC)c2)NC(=O)N1 |
| InChI | InChI=1S/C25H27N3O8/c1-4-6-10-18-21(24(30)35-5-2)22(27-25(31)26-18)15-11-12-19(20(14-15)34-3)36-23(29)16-8-7-9-17(13-16)28(32)33/h7-9,11-14,22H,4-6,10H2,1-3H3,(H2,26,27,31) |
| InChIKey | ATKQIWNORCHLKI-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 146.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.50 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|