C8H14N+ — CID 11052934
1-ethyl-5-methyl-2,3-dihydropyridin-1-ium (PubChem CID 11052934) has the molecular formula C8H14N+ and a molecular weight of 124.21 g/mol. Its IUPAC name is 1-ethyl-5-methyl-2,3-dihydropyridin-1-ium.
| Compound Name | 1-ethyl-5-methyl-2,3-dihydropyridin-1-ium |
|---|---|
| PubChem CID | 11052934 |
| Molecular Formula | C8H14N+ |
| Molecular Weight | 124.21 g/mol |
| Exact Mass | 124.11 |
| IUPAC Name | 1-ethyl-5-methyl-2,3-dihydropyridin-1-ium |
| SMILES | CC[N+]1=CC(C)=CCC1 |
| InChI | InChI=1S/C8H14N/c1-3-9-6-4-5-8(2)7-9/h5,7H,3-4,6H2,1-2H3/q+1 |
| InChIKey | SSPXQZWFOXRNKH-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 124.21 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|