C20H18Cl2N2O2S — CID 110529625
1-[4-[4-[(3,4-dichlorophenyl)methoxy]phenyl]-6-methyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidin-5-yl]ethanone (PubChem CID 110529625) has the molecular formula C20H18Cl2N2O2S and a molecular weight of 421.35 g/mol. Its IUPAC name is 1-[4-[4-[(3,4-dichlorophenyl)methoxy]phenyl]-6-methyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidin-5-yl]ethanone.
| Compound Name | 1-[4-[4-[(3,4-dichlorophenyl)methoxy]phenyl]-6-methyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidin-5-yl]ethanone |
|---|---|
| PubChem CID | 110529625 |
| Molecular Formula | C20H18Cl2N2O2S |
| Molecular Weight | 421.35 g/mol |
| Exact Mass | 420.05 |
| IUPAC Name | 1-[4-[4-[(3,4-dichlorophenyl)methoxy]phenyl]-6-methyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidin-5-yl]ethanone |
| SMILES | CC(=O)C1=C(C)NC(=S)NC1c1ccc(OCc2ccc(Cl)c(Cl)c2)cc1 |
| InChI | InChI=1S/C20H18Cl2N2O2S/c1-11-18(12(2)25)19(24-20(27)23-11)14-4-6-15(7-5-14)26-10-13-3-8-16(21)17(22)9-13/h3-9,19H,10H2,1-2H3,(H2,23,24,27) |
| InChIKey | FVFBAUJJWUTKLR-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.35 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|