C21H22ClN3O4S — CID 110530041
N-[(Z)-(3-chloro-4-ethoxy-5-methoxyphenyl)methylideneamino]-4-(3,4-dimethoxyphenyl)-1,3-thiazol-2-amine (PubChem CID 110530041) has the molecular formula C21H22ClN3O4S and a molecular weight of 447.94 g/mol. Its IUPAC name is N-[(Z)-(3-chloro-4-ethoxy-5-methoxyphenyl)methylideneamino]-4-(3,4-dimethoxyphenyl)-1,3-thiazol-2-amine.
| Compound Name | N-[(Z)-(3-chloro-4-ethoxy-5-methoxyphenyl)methylideneamino]-4-(3,4-dimethoxyphenyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 110530041 |
| Molecular Formula | C21H22ClN3O4S |
| Molecular Weight | 447.94 g/mol |
| Exact Mass | 447.10 |
| IUPAC Name | N-[(Z)-(3-chloro-4-ethoxy-5-methoxyphenyl)methylideneamino]-4-(3,4-dimethoxyphenyl)-1,3-thiazol-2-amine |
| SMILES | CCOc1c(Cl)cc(/C=N\Nc2nc(-c3ccc(OC)c(OC)c3)cs2)cc1OC |
| InChI | InChI=1S/C21H22ClN3O4S/c1-5-29-20-15(22)8-13(9-19(20)28-4)11-23-25-21-24-16(12-30-21)14-6-7-17(26-2)18(10-14)27-3/h6-12H,5H2,1-4H3,(H,24,25)/b23-11- |
| InChIKey | SPHXCSIAVQTEMY-KSEXSDGBSA-N |
| XLogP | 5.33 |
| TPSA | 74.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.94 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|