C21H22ClN3OS — CID 110532452
N-[(Z)-(3-chloro-4-propan-2-yloxyphenyl)methylideneamino]-4-(3,4-dimethylphenyl)-1,3-thiazol-2-amine (PubChem CID 110532452) has the molecular formula C21H22ClN3OS and a molecular weight of 399.95 g/mol. Its IUPAC name is N-[(Z)-(3-chloro-4-propan-2-yloxyphenyl)methylideneamino]-4-(3,4-dimethylphenyl)-1,3-thiazol-2-amine.
| Compound Name | N-[(Z)-(3-chloro-4-propan-2-yloxyphenyl)methylideneamino]-4-(3,4-dimethylphenyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 110532452 |
| Molecular Formula | C21H22ClN3OS |
| Molecular Weight | 399.95 g/mol |
| Exact Mass | 399.12 |
| IUPAC Name | N-[(Z)-(3-chloro-4-propan-2-yloxyphenyl)methylideneamino]-4-(3,4-dimethylphenyl)-1,3-thiazol-2-amine |
| SMILES | Cc1ccc(-c2csc(N/N=C\c3ccc(OC(C)C)c(Cl)c3)n2)cc1C |
| InChI | InChI=1S/C21H22ClN3OS/c1-13(2)26-20-8-6-16(10-18(20)22)11-23-25-21-24-19(12-27-21)17-7-5-14(3)15(4)9-17/h5-13H,1-4H3,(H,24,25)/b23-11- |
| InChIKey | LYUIRACAEFAQJJ-KSEXSDGBSA-N |
| XLogP | 6.31 |
| TPSA | 46.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.95 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|