C21H21ClN4O2S — CID 110530809
N-[4-[2-[(2Z)-2-[(3-chloro-4-propan-2-yloxyphenyl)methylidene]hydrazinyl]-1,3-thiazol-4-yl]phenyl]acetamide (PubChem CID 110530809) has the molecular formula C21H21ClN4O2S and a molecular weight of 428.95 g/mol. Its IUPAC name is N-[4-[2-[(2Z)-2-[(3-chloro-4-propan-2-yloxyphenyl)methylidene]hydrazinyl]-1,3-thiazol-4-yl]phenyl]acetamide.
| Compound Name | N-[4-[2-[(2Z)-2-[(3-chloro-4-propan-2-yloxyphenyl)methylidene]hydrazinyl]-1,3-thiazol-4-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 110530809 |
| Molecular Formula | C21H21ClN4O2S |
| Molecular Weight | 428.95 g/mol |
| Exact Mass | 428.11 |
| IUPAC Name | N-[4-[2-[(2Z)-2-[(3-chloro-4-propan-2-yloxyphenyl)methylidene]hydrazinyl]-1,3-thiazol-4-yl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(-c2csc(N/N=C\c3ccc(OC(C)C)c(Cl)c3)n2)cc1 |
| InChI | InChI=1S/C21H21ClN4O2S/c1-13(2)28-20-9-4-15(10-18(20)22)11-23-26-21-25-19(12-29-21)16-5-7-17(8-6-16)24-14(3)27/h4-13H,1-3H3,(H,24,27)(H,25,26)/b23-11- |
| InChIKey | RVUBALIYPVDBOZ-KSEXSDGBSA-N |
| XLogP | 5.66 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.95 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|