C22H30N4O3 — CID 110532508
2-[2-ethoxy-4-(1,4,5-triazatricyclo[5.2.2.02,6]undeca-2(6),3-dien-3-yl)phenoxy]-N,N-diethylacetamide (PubChem CID 110532508) has the molecular formula C22H30N4O3 and a molecular weight of 398.51 g/mol. Its IUPAC name is 2-[2-ethoxy-4-(1,4,5-triazatricyclo[5.2.2.02,6]undeca-2(6),3-dien-3-yl)phenoxy]-N,N-diethylacetamide.
| Compound Name | 2-[2-ethoxy-4-(1,4,5-triazatricyclo[5.2.2.02,6]undeca-2(6),3-dien-3-yl)phenoxy]-N,N-diethylacetamide |
|---|---|
| PubChem CID | 110532508 |
| Molecular Formula | C22H30N4O3 |
| Molecular Weight | 398.51 g/mol |
| Exact Mass | 398.23 |
| IUPAC Name | 2-[2-ethoxy-4-(1,4,5-triazatricyclo[5.2.2.02,6]undeca-2(6),3-dien-3-yl)phenoxy]-N,N-diethylacetamide |
| SMILES | CCOc1cc(-c2n[nH]c3c2N2CCC3CC2)ccc1OCC(=O)N(CC)CC |
| InChI | InChI=1S/C22H30N4O3/c1-4-25(5-2)19(27)14-29-17-8-7-16(13-18(17)28-6-3)21-22-20(23-24-21)15-9-11-26(22)12-10-15/h7-8,13,15H,4-6,9-12,14H2,1-3H3,(H,23,24) |
| InChIKey | SQOCPOMPUCLLED-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 70.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.51 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |