C19H27N3O3 — CID 110536164
2-[2-ethoxy-4-(1-ethylimidazol-2-yl)phenoxy]-N,N-diethylacetamide (PubChem CID 110536164) has the molecular formula C19H27N3O3 and a molecular weight of 345.44 g/mol. Its IUPAC name is 2-[2-ethoxy-4-(1-ethylimidazol-2-yl)phenoxy]-N,N-diethylacetamide.
| Compound Name | 2-[2-ethoxy-4-(1-ethylimidazol-2-yl)phenoxy]-N,N-diethylacetamide |
|---|---|
| PubChem CID | 110536164 |
| Molecular Formula | C19H27N3O3 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.21 |
| IUPAC Name | 2-[2-ethoxy-4-(1-ethylimidazol-2-yl)phenoxy]-N,N-diethylacetamide |
| SMILES | CCOc1cc(-c2nccn2CC)ccc1OCC(=O)N(CC)CC |
| InChI | InChI=1S/C19H27N3O3/c1-5-21(6-2)18(23)14-25-16-10-9-15(13-17(16)24-8-4)19-20-11-12-22(19)7-3/h9-13H,5-8,14H2,1-4H3 |
| InChIKey | JKSHLZSPZJRKCP-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 56.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |