C25H29NO3 — CID 110533030
(2Z)-2-[[4-[(2,5-dimethylphenyl)methoxy]-3-ethoxyphenyl]methylidene]-1-azabicyclo[2.2.2]octan-3-one (PubChem CID 110533030) has the molecular formula C25H29NO3 and a molecular weight of 391.51 g/mol. Its IUPAC name is (2Z)-2-[[4-[(2,5-dimethylphenyl)methoxy]-3-ethoxyphenyl]methylidene]-1-azabicyclo[2.2.2]octan-3-one.
| Compound Name | (2Z)-2-[[4-[(2,5-dimethylphenyl)methoxy]-3-ethoxyphenyl]methylidene]-1-azabicyclo[2.2.2]octan-3-one |
|---|---|
| PubChem CID | 110533030 |
| Molecular Formula | C25H29NO3 |
| Molecular Weight | 391.51 g/mol |
| Exact Mass | 391.21 |
| IUPAC Name | (2Z)-2-[[4-[(2,5-dimethylphenyl)methoxy]-3-ethoxyphenyl]methylidene]-1-azabicyclo[2.2.2]octan-3-one |
| SMILES | CCOc1cc(/C=C2/C(=O)C3CCN2CC3)ccc1OCc1cc(C)ccc1C |
| InChI | InChI=1S/C25H29NO3/c1-4-28-24-15-19(14-22-25(27)20-9-11-26(22)12-10-20)7-8-23(24)29-16-21-13-17(2)5-6-18(21)3/h5-8,13-15,20H,4,9-12,16H2,1-3H3/b22-14- |
| InChIKey | FLFLLVDXXBABTN-HMAPJEAMSA-N |
| XLogP | 4.92 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.51 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|