C10H10ClF2NO — CID 11053548
N-[1-(4-chlorophenyl)-2,2-difluoroethyl]acetamide (PubChem CID 11053548) has the molecular formula C10H10ClF2NO and a molecular weight of 233.65 g/mol. Its IUPAC name is N-[1-(4-chlorophenyl)-2,2-difluoroethyl]acetamide.
| Compound Name | N-[1-(4-chlorophenyl)-2,2-difluoroethyl]acetamide |
|---|---|
| PubChem CID | 11053548 |
| Molecular Formula | C10H10ClF2NO |
| Molecular Weight | 233.65 g/mol |
| Exact Mass | 233.04 |
| IUPAC Name | N-[1-(4-chlorophenyl)-2,2-difluoroethyl]acetamide |
| SMILES | CC(=O)NC(c1ccc(Cl)cc1)C(F)F |
| InChI | InChI=1S/C10H10ClF2NO/c1-6(15)14-9(10(12)13)7-2-4-8(11)5-3-7/h2-5,9-10H,1H3,(H,14,15) |
| InChIKey | YRQAPIXFVKUFDK-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.65 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |