C20H29N3O2 — CID 110536275
3-(3-ethoxy-4-pentoxyphenyl)-5-methyl-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine (PubChem CID 110536275) has the molecular formula C20H29N3O2 and a molecular weight of 343.47 g/mol. Its IUPAC name is 3-(3-ethoxy-4-pentoxyphenyl)-5-methyl-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine.
| Compound Name | 3-(3-ethoxy-4-pentoxyphenyl)-5-methyl-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine |
|---|---|
| PubChem CID | 110536275 |
| Molecular Formula | C20H29N3O2 |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.23 |
| IUPAC Name | 3-(3-ethoxy-4-pentoxyphenyl)-5-methyl-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine |
| SMILES | CCCCCOc1ccc(-c2n[nH]c3c2CN(C)CC3)cc1OCC |
| InChI | InChI=1S/C20H29N3O2/c1-4-6-7-12-25-18-9-8-15(13-19(18)24-5-2)20-16-14-23(3)11-10-17(16)21-22-20/h8-9,13H,4-7,10-12,14H2,1-3H3,(H,21,22) |
| InChIKey | AAVHJXAZSOUYIJ-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 50.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|