C25H28ClN3O3 — CID 108750248
(4-butoxy-3-ethoxyphenyl)-[3-(4-chlorophenyl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-5-yl]methanone (PubChem CID 108750248) has the molecular formula C25H28ClN3O3 and a molecular weight of 453.97 g/mol. Its IUPAC name is (4-butoxy-3-ethoxyphenyl)-[3-(4-chlorophenyl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-5-yl]methanone.
| Compound Name | (4-butoxy-3-ethoxyphenyl)-[3-(4-chlorophenyl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-5-yl]methanone |
|---|---|
| PubChem CID | 108750248 |
| Molecular Formula | C25H28ClN3O3 |
| Molecular Weight | 453.97 g/mol |
| Exact Mass | 453.18 |
| IUPAC Name | (4-butoxy-3-ethoxyphenyl)-[3-(4-chlorophenyl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-5-yl]methanone |
| SMILES | CCCCOc1ccc(C(=O)N2CCc3[nH]nc(-c4ccc(Cl)cc4)c3C2)cc1OCC |
| InChI | InChI=1S/C25H28ClN3O3/c1-3-5-14-32-22-11-8-18(15-23(22)31-4-2)25(30)29-13-12-21-20(16-29)24(28-27-21)17-6-9-19(26)10-7-17/h6-11,15H,3-5,12-14,16H2,1-2H3,(H,27,28) |
| InChIKey | IWIUDMFNERDRKF-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 67.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.97 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|