C18H14ClFN4O — CID 46999373
(2-chloro-4-pyridinyl)-[3-(4-fluorophenyl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-5-yl]methanone (PubChem CID 46999373) has the molecular formula C18H14ClFN4O and a molecular weight of 356.79 g/mol. Its IUPAC name is (2-chloro-4-pyridinyl)-[3-(4-fluorophenyl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-5-yl]methanone.
| Compound Name | (2-chloro-4-pyridinyl)-[3-(4-fluorophenyl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-5-yl]methanone |
|---|---|
| PubChem CID | 46999373 |
| Molecular Formula | C18H14ClFN4O |
| Molecular Weight | 356.79 g/mol |
| Exact Mass | 356.08 |
| IUPAC Name | (2-chloro-4-pyridinyl)-[3-(4-fluorophenyl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-5-yl]methanone |
| SMILES | O=C(c1ccnc(Cl)c1)N1CCc2[nH]nc(-c3ccc(F)cc3)c2C1 |
| InChI | InChI=1S/C18H14ClFN4O/c19-16-9-12(5-7-21-16)18(25)24-8-6-15-14(10-24)17(23-22-15)11-1-3-13(20)4-2-11/h1-5,7,9H,6,8,10H2,(H,22,23) |
| InChIKey | NJAREFOTZDYEEU-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.79 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|