C19H31NO3 — CID 110537539
3-[(2,4-diethoxyphenyl)methyl]-1-propylpiperidin-4-ol (PubChem CID 110537539) has the molecular formula C19H31NO3 and a molecular weight of 321.46 g/mol. Its IUPAC name is 3-[(2,4-diethoxyphenyl)methyl]-1-propylpiperidin-4-ol.
| Compound Name | 3-[(2,4-diethoxyphenyl)methyl]-1-propylpiperidin-4-ol |
|---|---|
| PubChem CID | 110537539 |
| Molecular Formula | C19H31NO3 |
| Molecular Weight | 321.46 g/mol |
| Exact Mass | 321.23 |
| IUPAC Name | 3-[(2,4-diethoxyphenyl)methyl]-1-propylpiperidin-4-ol |
| SMILES | CCCN1CCC(O)C(Cc2ccc(OCC)cc2OCC)C1 |
| InChI | InChI=1S/C19H31NO3/c1-4-10-20-11-9-18(21)16(14-20)12-15-7-8-17(22-5-2)13-19(15)23-6-3/h7-8,13,16,18,21H,4-6,9-12,14H2,1-3H3 |
| InChIKey | GNMJFEGXTSEYAD-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.46 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |