C22H28ClNO2 — CID 110534149
3-[[3-[(4-chlorophenyl)methoxy]phenyl]methyl]-1-propylpiperidin-4-ol (PubChem CID 110534149) has the molecular formula C22H28ClNO2 and a molecular weight of 373.92 g/mol. Its IUPAC name is 3-[[3-[(4-chlorophenyl)methoxy]phenyl]methyl]-1-propylpiperidin-4-ol.
| Compound Name | 3-[[3-[(4-chlorophenyl)methoxy]phenyl]methyl]-1-propylpiperidin-4-ol |
|---|---|
| PubChem CID | 110534149 |
| Molecular Formula | C22H28ClNO2 |
| Molecular Weight | 373.92 g/mol |
| Exact Mass | 373.18 |
| IUPAC Name | 3-[[3-[(4-chlorophenyl)methoxy]phenyl]methyl]-1-propylpiperidin-4-ol |
| SMILES | CCCN1CCC(O)C(Cc2cccc(OCc3ccc(Cl)cc3)c2)C1 |
| InChI | InChI=1S/C22H28ClNO2/c1-2-11-24-12-10-22(25)19(15-24)13-18-4-3-5-21(14-18)26-16-17-6-8-20(23)9-7-17/h3-9,14,19,22,25H,2,10-13,15-16H2,1H3 |
| InChIKey | COAWETGOZAVLBU-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.92 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |