C14H17Cl2N3 — CID 110538691
3-(2,3-dichlorophenyl)-5-ethyl-2,3,3a,4,6,7-hexahydropyrazolo[4,3-c]pyridine (PubChem CID 110538691) has the molecular formula C14H17Cl2N3 and a molecular weight of 298.22 g/mol. Its IUPAC name is 3-(2,3-dichlorophenyl)-5-ethyl-2,3,3a,4,6,7-hexahydropyrazolo[4,3-c]pyridine.
| Compound Name | 3-(2,3-dichlorophenyl)-5-ethyl-2,3,3a,4,6,7-hexahydropyrazolo[4,3-c]pyridine |
|---|---|
| PubChem CID | 110538691 |
| Molecular Formula | C14H17Cl2N3 |
| Molecular Weight | 298.22 g/mol |
| Exact Mass | 297.08 |
| IUPAC Name | 3-(2,3-dichlorophenyl)-5-ethyl-2,3,3a,4,6,7-hexahydropyrazolo[4,3-c]pyridine |
| SMILES | CCN1CCC2=NNC(c3cccc(Cl)c3Cl)C2C1 |
| InChI | InChI=1S/C14H17Cl2N3/c1-2-19-7-6-12-10(8-19)14(18-17-12)9-4-3-5-11(15)13(9)16/h3-5,10,14,18H,2,6-8H2,1H3 |
| InChIKey | JURZOFAWQOINBR-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.22 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |