C14H18N2O3 — CID 110539968
2-(4-ethoxy-3,5-dimethoxyphenyl)-1-methylimidazole (PubChem CID 110539968) has the molecular formula C14H18N2O3 and a molecular weight of 262.31 g/mol. Its IUPAC name is 2-(4-ethoxy-3,5-dimethoxyphenyl)-1-methylimidazole.
| Compound Name | 2-(4-ethoxy-3,5-dimethoxyphenyl)-1-methylimidazole |
|---|---|
| PubChem CID | 110539968 |
| Molecular Formula | C14H18N2O3 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | 2-(4-ethoxy-3,5-dimethoxyphenyl)-1-methylimidazole |
| SMILES | CCOc1c(OC)cc(-c2nccn2C)cc1OC |
| InChI | InChI=1S/C14H18N2O3/c1-5-19-13-11(17-3)8-10(9-12(13)18-4)14-15-6-7-16(14)2/h6-9H,5H2,1-4H3 |
| InChIKey | QJIBCZNIXRUZPM-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 45.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |