C14H17ClN2O4S — CID 110536202
2-(3-chloro-4,5-diethoxyphenyl)-1-methylsulfonylimidazole (PubChem CID 110536202) has the molecular formula C14H17ClN2O4S and a molecular weight of 344.82 g/mol. Its IUPAC name is 2-(3-chloro-4,5-diethoxyphenyl)-1-methylsulfonylimidazole.
| Compound Name | 2-(3-chloro-4,5-diethoxyphenyl)-1-methylsulfonylimidazole |
|---|---|
| PubChem CID | 110536202 |
| Molecular Formula | C14H17ClN2O4S |
| Molecular Weight | 344.82 g/mol |
| Exact Mass | 344.06 |
| IUPAC Name | 2-(3-chloro-4,5-diethoxyphenyl)-1-methylsulfonylimidazole |
| SMILES | CCOc1cc(-c2nccn2S(C)(=O)=O)cc(Cl)c1OCC |
| InChI | InChI=1S/C14H17ClN2O4S/c1-4-20-12-9-10(8-11(15)13(12)21-5-2)14-16-6-7-17(14)22(3,18)19/h6-9H,4-5H2,1-3H3 |
| InChIKey | YZEPIMLKXBTBNU-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 70.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.82 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |