C13H14Cl2N2O3S — CID 110535930
2-(3,5-dichloro-4-propan-2-yloxyphenyl)-1-methylsulfonylimidazole (PubChem CID 110535930) has the molecular formula C13H14Cl2N2O3S and a molecular weight of 349.24 g/mol. Its IUPAC name is 2-(3,5-dichloro-4-propan-2-yloxyphenyl)-1-methylsulfonylimidazole.
| Compound Name | 2-(3,5-dichloro-4-propan-2-yloxyphenyl)-1-methylsulfonylimidazole |
|---|---|
| PubChem CID | 110535930 |
| Molecular Formula | C13H14Cl2N2O3S |
| Molecular Weight | 349.24 g/mol |
| Exact Mass | 348.01 |
| IUPAC Name | 2-(3,5-dichloro-4-propan-2-yloxyphenyl)-1-methylsulfonylimidazole |
| SMILES | CC(C)Oc1c(Cl)cc(-c2nccn2S(C)(=O)=O)cc1Cl |
| InChI | InChI=1S/C13H14Cl2N2O3S/c1-8(2)20-12-10(14)6-9(7-11(12)15)13-16-4-5-17(13)21(3,18)19/h4-8H,1-3H3 |
| InChIKey | WHLZIHGLOUDQJW-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.24 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |