C16H19NO2 — CID 110540113
(2Z)-2-[(3-ethoxyphenyl)methylidene]-1-azabicyclo[2.2.2]octan-3-one (PubChem CID 110540113) has the molecular formula C16H19NO2 and a molecular weight of 257.33 g/mol. Its IUPAC name is (2Z)-2-[(3-ethoxyphenyl)methylidene]-1-azabicyclo[2.2.2]octan-3-one.
| Compound Name | (2Z)-2-[(3-ethoxyphenyl)methylidene]-1-azabicyclo[2.2.2]octan-3-one |
|---|---|
| PubChem CID | 110540113 |
| Molecular Formula | C16H19NO2 |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | (2Z)-2-[(3-ethoxyphenyl)methylidene]-1-azabicyclo[2.2.2]octan-3-one |
| SMILES | CCOc1cccc(/C=C2/C(=O)C3CCN2CC3)c1 |
| InChI | InChI=1S/C16H19NO2/c1-2-19-14-5-3-4-12(10-14)11-15-16(18)13-6-8-17(15)9-7-13/h3-5,10-11,13H,2,6-9H2,1H3/b15-11- |
| InChIKey | SUGJGAWOVOYPBE-PTNGSMBKSA-N |
| XLogP | 2.72 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|