C11H24O4Si — CID 11054016
(2S)-3-[tert-butyl(dimethyl)silyl]oxy-2-(methoxymethoxy)propanal (PubChem CID 11054016) has the molecular formula C11H24O4Si and a molecular weight of 248.39 g/mol. Its IUPAC name is (2S)-3-[tert-butyl(dimethyl)silyl]oxy-2-(methoxymethoxy)propanal.
| Compound Name | (2S)-3-[tert-butyl(dimethyl)silyl]oxy-2-(methoxymethoxy)propanal |
|---|---|
| PubChem CID | 11054016 |
| Molecular Formula | C11H24O4Si |
| Molecular Weight | 248.39 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | (2S)-3-[tert-butyl(dimethyl)silyl]oxy-2-(methoxymethoxy)propanal |
| SMILES | COCO[C@H](C=O)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C11H24O4Si/c1-11(2,3)16(5,6)15-8-10(7-12)14-9-13-4/h7,10H,8-9H2,1-6H3/t10-/m1/s1 |
| InChIKey | NKWFYSLNEGHPEW-SNVBAGLBSA-N |
| XLogP | 2.20 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.39 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|