C9H8Cl2N2 — CID 110540705
2-(2,3-dichlorophenyl)-4,5-dihydro-1H-imidazole (PubChem CID 110540705) has the molecular formula C9H8Cl2N2 and a molecular weight of 215.08 g/mol. Its IUPAC name is 2-(2,3-dichlorophenyl)-4,5-dihydro-1H-imidazole.
| Compound Name | 2-(2,3-dichlorophenyl)-4,5-dihydro-1H-imidazole |
|---|---|
| PubChem CID | 110540705 |
| Molecular Formula | C9H8Cl2N2 |
| Molecular Weight | 215.08 g/mol |
| Exact Mass | 214.01 |
| IUPAC Name | 2-(2,3-dichlorophenyl)-4,5-dihydro-1H-imidazole |
| SMILES | Clc1cccc(C2=NCCN2)c1Cl |
| InChI | InChI=1S/C9H8Cl2N2/c10-7-3-1-2-6(8(7)11)9-12-4-5-13-9/h1-3H,4-5H2,(H,12,13) |
| InChIKey | QIKJYKAMCWVNBG-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.08 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |