C12H16N2O — CID 110540746
2-(3-ethoxyphenyl)-1-methyl-4,5-dihydroimidazole (PubChem CID 110540746) has the molecular formula C12H16N2O and a molecular weight of 204.27 g/mol. Its IUPAC name is 2-(3-ethoxyphenyl)-1-methyl-4,5-dihydroimidazole.
| Compound Name | 2-(3-ethoxyphenyl)-1-methyl-4,5-dihydroimidazole |
|---|---|
| PubChem CID | 110540746 |
| Molecular Formula | C12H16N2O |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.13 |
| IUPAC Name | 2-(3-ethoxyphenyl)-1-methyl-4,5-dihydroimidazole |
| SMILES | CCOc1cccc(C2=NCCN2C)c1 |
| InChI | InChI=1S/C12H16N2O/c1-3-15-11-6-4-5-10(9-11)12-13-7-8-14(12)2/h4-6,9H,3,7-8H2,1-2H3 |
| InChIKey | XVEIBYNHNMXEIQ-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |