C27H23N3O4 — CID 110540932
3-(3,4-dihydro-2H-quinolin-1-yl)-4-(4-nitrophenyl)-1-(2-phenylethyl)pyrrole-2,5-dione (PubChem CID 110540932) has the molecular formula C27H23N3O4 and a molecular weight of 453.50 g/mol. Its IUPAC name is 3-(3,4-dihydro-2H-quinolin-1-yl)-4-(4-nitrophenyl)-1-(2-phenylethyl)pyrrole-2,5-dione.
| Compound Name | 3-(3,4-dihydro-2H-quinolin-1-yl)-4-(4-nitrophenyl)-1-(2-phenylethyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110540932 |
| Molecular Formula | C27H23N3O4 |
| Molecular Weight | 453.50 g/mol |
| Exact Mass | 453.17 |
| IUPAC Name | 3-(3,4-dihydro-2H-quinolin-1-yl)-4-(4-nitrophenyl)-1-(2-phenylethyl)pyrrole-2,5-dione |
| SMILES | O=C1C(c2ccc([N+](=O)[O-])cc2)=C(N2CCCc3ccccc32)C(=O)N1CCc1ccccc1 |
| InChI | InChI=1S/C27H23N3O4/c31-26-24(21-12-14-22(15-13-21)30(33)34)25(28-17-6-10-20-9-4-5-11-23(20)28)27(32)29(26)18-16-19-7-2-1-3-8-19/h1-5,7-9,11-15H,6,10,16-18H2 |
| InChIKey | QHTGQQDEAYMIHO-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 83.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.50 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|