C24H27N3O4 — CID 110541245
3-[benzyl(ethyl)amino]-4-(4-nitrophenyl)-1-pentylpyrrole-2,5-dione (PubChem CID 110541245) has the molecular formula C24H27N3O4 and a molecular weight of 421.50 g/mol. Its IUPAC name is 3-[benzyl(ethyl)amino]-4-(4-nitrophenyl)-1-pentylpyrrole-2,5-dione.
| Compound Name | 3-[benzyl(ethyl)amino]-4-(4-nitrophenyl)-1-pentylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 110541245 |
| Molecular Formula | C24H27N3O4 |
| Molecular Weight | 421.50 g/mol |
| Exact Mass | 421.20 |
| IUPAC Name | 3-[benzyl(ethyl)amino]-4-(4-nitrophenyl)-1-pentylpyrrole-2,5-dione |
| SMILES | CCCCCN1C(=O)C(c2ccc([N+](=O)[O-])cc2)=C(N(CC)Cc2ccccc2)C1=O |
| InChI | InChI=1S/C24H27N3O4/c1-3-5-9-16-26-23(28)21(19-12-14-20(15-13-19)27(30)31)22(24(26)29)25(4-2)17-18-10-7-6-8-11-18/h6-8,10-15H,3-5,9,16-17H2,1-2H3 |
| InChIKey | ZPBMKKXTCFCXDT-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 83.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.50 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|