C28H36N2O3 — CID 110551154
3-[benzyl(ethyl)amino]-4-[4-(2-methylpropoxy)phenyl]-1-pentylpyrrole-2,5-dione (PubChem CID 110551154) has the molecular formula C28H36N2O3 and a molecular weight of 448.61 g/mol. Its IUPAC name is 3-[benzyl(ethyl)amino]-4-[4-(2-methylpropoxy)phenyl]-1-pentylpyrrole-2,5-dione.
| Compound Name | 3-[benzyl(ethyl)amino]-4-[4-(2-methylpropoxy)phenyl]-1-pentylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 110551154 |
| Molecular Formula | C28H36N2O3 |
| Molecular Weight | 448.61 g/mol |
| Exact Mass | 448.27 |
| IUPAC Name | 3-[benzyl(ethyl)amino]-4-[4-(2-methylpropoxy)phenyl]-1-pentylpyrrole-2,5-dione |
| SMILES | CCCCCN1C(=O)C(c2ccc(OCC(C)C)cc2)=C(N(CC)Cc2ccccc2)C1=O |
| InChI | InChI=1S/C28H36N2O3/c1-5-7-11-18-30-27(31)25(23-14-16-24(17-15-23)33-20-21(3)4)26(28(30)32)29(6-2)19-22-12-9-8-10-13-22/h8-10,12-17,21H,5-7,11,18-20H2,1-4H3 |
| InChIKey | POXLKRWKTJOANV-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.61 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|