C13H18O5 — CID 11054201
methyl (4R,4aS,5S)-4,5-dihydroxy-1-methyl-8-oxo-2,3,4,5,6,7-hexahydronaphthalene-4a-carboxylate (PubChem CID 11054201) has the molecular formula C13H18O5 and a molecular weight of 254.28 g/mol. Its IUPAC name is methyl (4R,4aS,5S)-4,5-dihydroxy-1-methyl-8-oxo-2,3,4,5,6,7-hexahydronaphthalene-4a-carboxylate.
| Compound Name | methyl (4R,4aS,5S)-4,5-dihydroxy-1-methyl-8-oxo-2,3,4,5,6,7-hexahydronaphthalene-4a-carboxylate |
|---|---|
| PubChem CID | 11054201 |
| Molecular Formula | C13H18O5 |
| Molecular Weight | 254.28 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | methyl (4R,4aS,5S)-4,5-dihydroxy-1-methyl-8-oxo-2,3,4,5,6,7-hexahydronaphthalene-4a-carboxylate |
| SMILES | COC(=O)[C@@]12C(=C(C)CC[C@H]1O)C(=O)CC[C@@H]2O |
| InChI | InChI=1S/C13H18O5/c1-7-3-5-9(15)13(12(17)18-2)10(16)6-4-8(14)11(7)13/h9-10,15-16H,3-6H2,1-2H3/t9-,10+,13+/m1/s1 |
| InChIKey | KJPPUIZKWNFNPV-NRUUGDAUSA-N |
| XLogP | 0.34 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.28 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |