C19H30O5Si — CID 11143091
methyl (4R,4aS)-4-[tert-butyl(dimethyl)silyl]oxy-8-methyl-1,5-dioxo-3,4,6,7-tetrahydro-2H-naphthalene-4a-carboxylate (PubChem CID 11143091) has the molecular formula C19H30O5Si and a molecular weight of 366.53 g/mol. Its IUPAC name is methyl (4R,4aS)-4-[tert-butyl(dimethyl)silyl]oxy-8-methyl-1,5-dioxo-3,4,6,7-tetrahydro-2H-naphthalene-4a-carboxylate.
| Compound Name | methyl (4R,4aS)-4-[tert-butyl(dimethyl)silyl]oxy-8-methyl-1,5-dioxo-3,4,6,7-tetrahydro-2H-naphthalene-4a-carboxylate |
|---|---|
| PubChem CID | 11143091 |
| Molecular Formula | C19H30O5Si |
| Molecular Weight | 366.53 g/mol |
| Exact Mass | 366.19 |
| IUPAC Name | methyl (4R,4aS)-4-[tert-butyl(dimethyl)silyl]oxy-8-methyl-1,5-dioxo-3,4,6,7-tetrahydro-2H-naphthalene-4a-carboxylate |
| SMILES | COC(=O)[C@@]12C(=O)CCC(C)=C1C(=O)CC[C@H]2O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H30O5Si/c1-12-8-10-14(21)19(17(22)23-5)15(11-9-13(20)16(12)19)24-25(6,7)18(2,3)4/h15H,8-11H2,1-7H3/t15-,19-/m1/s1 |
| InChIKey | HPISTJQNBIZAIA-DNVCBOLYSA-N |
| XLogP | 3.58 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.53 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|