C20H34O4Si — CID 11326064
ethyl (4aR,5R)-5-[tert-butyl(dimethyl)silyl]oxy-4a-methyl-2-oxo-3,4,5,6,7,8-hexahydronaphthalene-1-carboxylate (PubChem CID 11326064) has the molecular formula C20H34O4Si and a molecular weight of 366.57 g/mol. Its IUPAC name is ethyl (4aR,5R)-5-[tert-butyl(dimethyl)silyl]oxy-4a-methyl-2-oxo-3,4,5,6,7,8-hexahydronaphthalene-1-carboxylate.
| Compound Name | ethyl (4aR,5R)-5-[tert-butyl(dimethyl)silyl]oxy-4a-methyl-2-oxo-3,4,5,6,7,8-hexahydronaphthalene-1-carboxylate |
|---|---|
| PubChem CID | 11326064 |
| Molecular Formula | C20H34O4Si |
| Molecular Weight | 366.57 g/mol |
| Exact Mass | 366.22 |
| IUPAC Name | ethyl (4aR,5R)-5-[tert-butyl(dimethyl)silyl]oxy-4a-methyl-2-oxo-3,4,5,6,7,8-hexahydronaphthalene-1-carboxylate |
| SMILES | CCOC(=O)C1=C2CCC[C@@H](O[Si](C)(C)C(C)(C)C)[C@]2(C)CCC1=O |
| InChI | InChI=1S/C20H34O4Si/c1-8-23-18(22)17-14-10-9-11-16(20(14,5)13-12-15(17)21)24-25(6,7)19(2,3)4/h16H,8-13H2,1-7H3/t16-,20-/m1/s1 |
| InChIKey | AVVYFAQXEBFKHW-OXQOHEQNSA-N |
| XLogP | 4.79 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.57 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|