C22H38O6Si — CID 101050526
ethyl (4aS,5S,8aR)-7-[tert-butyl(dimethyl)silyl]oxy-5-methoxy-2,2,6-trimethyl-4-oxo-3,5,8,8a-tetrahydrochromene-4a-carboxylate (PubChem CID 101050526) has the molecular formula C22H38O6Si and a molecular weight of 426.63 g/mol. Its IUPAC name is ethyl (4aS,5S,8aR)-7-[tert-butyl(dimethyl)silyl]oxy-5-methoxy-2,2,6-trimethyl-4-oxo-3,5,8,8a-tetrahydrochromene-4a-carboxylate.
| Compound Name | ethyl (4aS,5S,8aR)-7-[tert-butyl(dimethyl)silyl]oxy-5-methoxy-2,2,6-trimethyl-4-oxo-3,5,8,8a-tetrahydrochromene-4a-carboxylate |
|---|---|
| PubChem CID | 101050526 |
| Molecular Formula | C22H38O6Si |
| Molecular Weight | 426.63 g/mol |
| Exact Mass | 426.24 |
| IUPAC Name | ethyl (4aS,5S,8aR)-7-[tert-butyl(dimethyl)silyl]oxy-5-methoxy-2,2,6-trimethyl-4-oxo-3,5,8,8a-tetrahydrochromene-4a-carboxylate |
| SMILES | CCOC(=O)[C@@]12C(=O)CC(C)(C)O[C@@H]1CC(O[Si](C)(C)C(C)(C)C)=C(C)[C@@H]2OC |
| InChI | InChI=1S/C22H38O6Si/c1-11-26-19(24)22-16(23)13-21(6,7)27-17(22)12-15(14(2)18(22)25-8)28-29(9,10)20(3,4)5/h17-18H,11-13H2,1-10H3/t17-,18+,22+/m1/s1 |
| InChIKey | NJCQANIJRJBRCZ-FGSXEWAUSA-N |
| XLogP | 4.39 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.63 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|