C22H38O5Si — CID 10501742
ethyl (4aR,8aR)-7-[tert-butyl(dimethyl)silyl]oxy-2,2,5,5-tetramethyl-4-oxo-8,8a-dihydro-3H-chromene-4a-carboxylate (PubChem CID 10501742) has the molecular formula C22H38O5Si and a molecular weight of 410.63 g/mol. Its IUPAC name is ethyl (4aR,8aR)-7-[tert-butyl(dimethyl)silyl]oxy-2,2,5,5-tetramethyl-4-oxo-8,8a-dihydro-3H-chromene-4a-carboxylate.
| Compound Name | ethyl (4aR,8aR)-7-[tert-butyl(dimethyl)silyl]oxy-2,2,5,5-tetramethyl-4-oxo-8,8a-dihydro-3H-chromene-4a-carboxylate |
|---|---|
| PubChem CID | 10501742 |
| Molecular Formula | C22H38O5Si |
| Molecular Weight | 410.63 g/mol |
| Exact Mass | 410.25 |
| IUPAC Name | ethyl (4aR,8aR)-7-[tert-butyl(dimethyl)silyl]oxy-2,2,5,5-tetramethyl-4-oxo-8,8a-dihydro-3H-chromene-4a-carboxylate |
| SMILES | CCOC(=O)[C@@]12C(=O)CC(C)(C)O[C@@H]1CC(O[Si](C)(C)C(C)(C)C)=CC2(C)C |
| InChI | InChI=1S/C22H38O5Si/c1-11-25-18(24)22-16(23)14-21(7,8)26-17(22)12-15(13-20(22,5)6)27-28(9,10)19(2,3)4/h13,17H,11-12,14H2,1-10H3/t17-,22-/m1/s1 |
| InChIKey | YXUSWIDSPRUBKQ-VGOFRKELSA-N |
| XLogP | 5.01 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.63 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|