C34H60O6Si2 — CID 10394106
[(1S,3R,7R,8R,8aR)-8-[2-[(2R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-6-oxooxan-2-yl]ethyl]-3,7-dimethyl-6-trimethylsilyloxy-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2,2-dimethylbutanoate (PubChem CID 10394106) has the molecular formula C34H60O6Si2 and a molecular weight of 621.02 g/mol. Its IUPAC name is [(1S,3R,7R,8R,8aR)-8-[2-[(2R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-6-oxooxan-2-yl]ethyl]-3,7-dimethyl-6-trimethylsilyloxy-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2,2-dimethylbutanoate.
| Compound Name | [(1S,3R,7R,8R,8aR)-8-[2-[(2R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-6-oxooxan-2-yl]ethyl]-3,7-dimethyl-6-trimethylsilyloxy-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 10394106 |
| Molecular Formula | C34H60O6Si2 |
| Molecular Weight | 621.02 g/mol |
| Exact Mass | 620.39 |
| IUPAC Name | [(1S,3R,7R,8R,8aR)-8-[2-[(2R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-6-oxooxan-2-yl]ethyl]-3,7-dimethyl-6-trimethylsilyloxy-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)O[C@H]1C[C@@H](C)C=C2C=C(O[Si](C)(C)C)[C@H](C)[C@H](CC[C@@H]3C[C@@H](O[Si](C)(C)C(C)(C)C)CC(=O)O3)[C@H]21 |
| InChI | InChI=1S/C34H60O6Si2/c1-14-34(7,8)32(36)38-29-18-22(2)17-24-19-28(40-41(9,10)11)23(3)27(31(24)29)16-15-25-20-26(21-30(35)37-25)39-42(12,13)33(4,5)6/h17,19,22-23,25-27,29,31H,14-16,18,20-21H2,1-13H3/t22-,23+,25+,26+,27-,29-,31-/m0/s1 |
| InChIKey | SQDNPISNQJPQID-JEOAPVKRSA-N |
| XLogP | 8.79 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.02 |
| LogP ≤ 5 | 8.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|