C27H44O5Si — CID 10227471
[3,7-dimethyl-8-[2-(6-oxo-4-trimethylsilyloxyoxan-2-yl)ethyl]-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2-methylbutanoate (PubChem CID 10227471) has the molecular formula C27H44O5Si and a molecular weight of 476.73 g/mol. Its IUPAC name is [3,7-dimethyl-8-[2-(6-oxo-4-trimethylsilyloxyoxan-2-yl)ethyl]-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2-methylbutanoate.
| Compound Name | [3,7-dimethyl-8-[2-(6-oxo-4-trimethylsilyloxyoxan-2-yl)ethyl]-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2-methylbutanoate |
|---|---|
| PubChem CID | 10227471 |
| Molecular Formula | C27H44O5Si |
| Molecular Weight | 476.73 g/mol |
| Exact Mass | 476.30 |
| IUPAC Name | [3,7-dimethyl-8-[2-(6-oxo-4-trimethylsilyloxyoxan-2-yl)ethyl]-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2-methylbutanoate |
| SMILES | CCC(C)C(=O)OC1CC(C)C=C2C=CC(C)C(CCC3CC(O[Si](C)(C)C)CC(=O)O3)C21 |
| InChI | InChI=1S/C27H44O5Si/c1-8-18(3)27(29)31-24-14-17(2)13-20-10-9-19(4)23(26(20)24)12-11-21-15-22(16-25(28)30-21)32-33(5,6)7/h9-10,13,17-19,21-24,26H,8,11-12,14-16H2,1-7H3 |
| InChIKey | CZWIDMHJBWCSKO-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.73 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|