C24H35NO5 — CID 142198490
[(1S,3R,7S,8S,8aR)-3,7-dimethyl-8-[2-[(4R)-4-nitroso-6-oxooxan-2-yl]ethyl]-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] (2S)-2-methylbutanoate (PubChem CID 142198490) has the molecular formula C24H35NO5 and a molecular weight of 417.55 g/mol. Its IUPAC name is [(1S,3R,7S,8S,8aR)-3,7-dimethyl-8-[2-[(4R)-4-nitroso-6-oxooxan-2-yl]ethyl]-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] (2S)-2-methylbutanoate.
| Compound Name | [(1S,3R,7S,8S,8aR)-3,7-dimethyl-8-[2-[(4R)-4-nitroso-6-oxooxan-2-yl]ethyl]-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] (2S)-2-methylbutanoate |
|---|---|
| PubChem CID | 142198490 |
| Molecular Formula | C24H35NO5 |
| Molecular Weight | 417.55 g/mol |
| Exact Mass | 417.25 |
| IUPAC Name | [(1S,3R,7S,8S,8aR)-3,7-dimethyl-8-[2-[(4R)-4-nitroso-6-oxooxan-2-yl]ethyl]-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] (2S)-2-methylbutanoate |
| SMILES | CC[C@H](C)C(=O)O[C@H]1C[C@@H](C)C=C2C=C[C@H](C)[C@H](CCC3C[C@@H](N=O)CC(=O)O3)[C@H]21 |
| InChI | InChI=1S/C24H35NO5/c1-5-15(3)24(27)30-21-11-14(2)10-17-7-6-16(4)20(23(17)21)9-8-19-12-18(25-28)13-22(26)29-19/h6-7,10,14-16,18-21,23H,5,8-9,11-13H2,1-4H3/t14-,15-,16-,18+,19?,20-,21-,23-/m0/s1 |
| InChIKey | RURBSIJKUGAQPJ-KVVRZSONSA-N |
| XLogP | 4.97 |
| TPSA | 82.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.55 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |