C21H36O5Si — CID 10548793
ethyl (4aR,8aR)-7-[tert-butyl(dimethyl)silyl]oxy-2,2,5-trimethyl-4-oxo-3,5,8,8a-tetrahydrochromene-4a-carboxylate (PubChem CID 10548793) has the molecular formula C21H36O5Si and a molecular weight of 396.60 g/mol. Its IUPAC name is ethyl (4aR,8aR)-7-[tert-butyl(dimethyl)silyl]oxy-2,2,5-trimethyl-4-oxo-3,5,8,8a-tetrahydrochromene-4a-carboxylate.
| Compound Name | ethyl (4aR,8aR)-7-[tert-butyl(dimethyl)silyl]oxy-2,2,5-trimethyl-4-oxo-3,5,8,8a-tetrahydrochromene-4a-carboxylate |
|---|---|
| PubChem CID | 10548793 |
| Molecular Formula | C21H36O5Si |
| Molecular Weight | 396.60 g/mol |
| Exact Mass | 396.23 |
| IUPAC Name | ethyl (4aR,8aR)-7-[tert-butyl(dimethyl)silyl]oxy-2,2,5-trimethyl-4-oxo-3,5,8,8a-tetrahydrochromene-4a-carboxylate |
| SMILES | CCOC(=O)[C@@]12C(=O)CC(C)(C)O[C@@H]1CC(O[Si](C)(C)C(C)(C)C)=CC2C |
| InChI | InChI=1S/C21H36O5Si/c1-10-24-18(23)21-14(2)11-15(26-27(8,9)19(3,4)5)12-17(21)25-20(6,7)13-16(21)22/h11,14,17H,10,12-13H2,1-9H3/t14?,17-,21+/m1/s1 |
| InChIKey | SVQVVELATMVGMG-ZFXWJCKASA-N |
| XLogP | 4.62 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.60 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|