C22H36O6Si — CID 10387660
(1R,4R,10S,11S,12S)-11-butyl-4-methyl-8,8-di(propan-2-yl)-3,7,9,13-tetraoxa-8-silatricyclo[10.2.2.01,10]hexadec-15-ene-2,14-dione (PubChem CID 10387660) has the molecular formula C22H36O6Si and a molecular weight of 424.61 g/mol. Its IUPAC name is (1R,4R,10S,11S,12S)-11-butyl-4-methyl-8,8-di(propan-2-yl)-3,7,9,13-tetraoxa-8-silatricyclo[10.2.2.01,10]hexadec-15-ene-2,14-dione.
| Compound Name | (1R,4R,10S,11S,12S)-11-butyl-4-methyl-8,8-di(propan-2-yl)-3,7,9,13-tetraoxa-8-silatricyclo[10.2.2.01,10]hexadec-15-ene-2,14-dione |
|---|---|
| PubChem CID | 10387660 |
| Molecular Formula | C22H36O6Si |
| Molecular Weight | 424.61 g/mol |
| Exact Mass | 424.23 |
| IUPAC Name | (1R,4R,10S,11S,12S)-11-butyl-4-methyl-8,8-di(propan-2-yl)-3,7,9,13-tetraoxa-8-silatricyclo[10.2.2.01,10]hexadec-15-ene-2,14-dione |
| SMILES | CCCC[C@H]1[C@@H]2C=C[C@@]3(C(=O)O[C@H](C)CCO[Si](C(C)C)(C(C)C)O[C@@H]13)C(=O)O2 |
| InChI | InChI=1S/C22H36O6Si/c1-7-8-9-17-18-10-12-22(21(24)27-18)19(17)28-29(14(2)3,15(4)5)25-13-11-16(6)26-20(22)23/h10,12,14-19H,7-9,11,13H2,1-6H3/t16-,17+,18+,19+,22-/m1/s1 |
| InChIKey | MRRUAXDQOQRFNC-NOYKIMNZSA-N |
| XLogP | 4.27 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.61 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|