C30H58O6Si3 — CID 10864932
methyl (4S,4aR,5S,6R)-4,5,6-tris[[tert-butyl(dimethyl)silyl]oxy]-1-oxo-2,3,4,5,6,7-hexahydronaphthalene-4a-carboxylate (PubChem CID 10864932) has the molecular formula C30H58O6Si3 and a molecular weight of 599.05 g/mol. Its IUPAC name is methyl (4S,4aR,5S,6R)-4,5,6-tris[[tert-butyl(dimethyl)silyl]oxy]-1-oxo-2,3,4,5,6,7-hexahydronaphthalene-4a-carboxylate.
| Compound Name | methyl (4S,4aR,5S,6R)-4,5,6-tris[[tert-butyl(dimethyl)silyl]oxy]-1-oxo-2,3,4,5,6,7-hexahydronaphthalene-4a-carboxylate |
|---|---|
| PubChem CID | 10864932 |
| Molecular Formula | C30H58O6Si3 |
| Molecular Weight | 599.05 g/mol |
| Exact Mass | 598.35 |
| IUPAC Name | methyl (4S,4aR,5S,6R)-4,5,6-tris[[tert-butyl(dimethyl)silyl]oxy]-1-oxo-2,3,4,5,6,7-hexahydronaphthalene-4a-carboxylate |
| SMILES | COC(=O)[C@@]12C(=CC[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1O[Si](C)(C)C(C)(C)C)C(=O)CC[C@@H]2O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C30H58O6Si3/c1-27(2,3)37(11,12)34-23-19-17-21-22(31)18-20-24(35-38(13,14)28(4,5)6)30(21,26(32)33-10)25(23)36-39(15,16)29(7,8)9/h17,23-25H,18-20H2,1-16H3/t23-,24+,25-,30-/m1/s1 |
| InChIKey | MTSCLTFMVWANCN-FJRSXGRASA-N |
| XLogP | 8.01 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.05 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|