C20H34O6Si — CID 101337411
methyl 3-[tert-butyl(dimethyl)silyl]oxy-3,4-dimethoxy-8-oxo-2,4,4a,5,6,7-hexahydronaphthalene-2-carboxylate (PubChem CID 101337411) has the molecular formula C20H34O6Si and a molecular weight of 398.57 g/mol. Its IUPAC name is methyl 3-[tert-butyl(dimethyl)silyl]oxy-3,4-dimethoxy-8-oxo-2,4,4a,5,6,7-hexahydronaphthalene-2-carboxylate.
| Compound Name | methyl 3-[tert-butyl(dimethyl)silyl]oxy-3,4-dimethoxy-8-oxo-2,4,4a,5,6,7-hexahydronaphthalene-2-carboxylate |
|---|---|
| PubChem CID | 101337411 |
| Molecular Formula | C20H34O6Si |
| Molecular Weight | 398.57 g/mol |
| Exact Mass | 398.21 |
| IUPAC Name | methyl 3-[tert-butyl(dimethyl)silyl]oxy-3,4-dimethoxy-8-oxo-2,4,4a,5,6,7-hexahydronaphthalene-2-carboxylate |
| SMILES | COC(=O)C1C=C2C(=O)CCCC2C(OC)C1(OC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H34O6Si/c1-19(2,3)27(7,8)26-20(25-6)15(18(22)24-5)12-14-13(17(20)23-4)10-9-11-16(14)21/h12-13,15,17H,9-11H2,1-8H3 |
| InChIKey | DXLRURLZJJQZKY-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.57 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|