C23H42O4Si — CID 23253340
(3R,4S,5S,7R,9E,11R,12R)-4-[tert-butyl(dimethyl)silyl]oxy-12-ethyl-3,5,7,11-tetramethyl-1-oxacyclododec-9-ene-2,8-dione (PubChem CID 23253340) has the molecular formula C23H42O4Si and a molecular weight of 410.67 g/mol. Its IUPAC name is (3R,4S,5S,7R,9E,11R,12R)-4-[tert-butyl(dimethyl)silyl]oxy-12-ethyl-3,5,7,11-tetramethyl-1-oxacyclododec-9-ene-2,8-dione.
| Compound Name | (3R,4S,5S,7R,9E,11R,12R)-4-[tert-butyl(dimethyl)silyl]oxy-12-ethyl-3,5,7,11-tetramethyl-1-oxacyclododec-9-ene-2,8-dione |
|---|---|
| PubChem CID | 23253340 |
| Molecular Formula | C23H42O4Si |
| Molecular Weight | 410.67 g/mol |
| Exact Mass | 410.29 |
| IUPAC Name | (3R,4S,5S,7R,9E,11R,12R)-4-[tert-butyl(dimethyl)silyl]oxy-12-ethyl-3,5,7,11-tetramethyl-1-oxacyclododec-9-ene-2,8-dione |
| SMILES | CC[C@H]1OC(=O)[C@H](C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)C[C@@H](C)C(=O)/C=C/[C@H]1C |
| InChI | InChI=1S/C23H42O4Si/c1-11-20-15(2)12-13-19(24)16(3)14-17(4)21(18(5)22(25)26-20)27-28(9,10)23(6,7)8/h12-13,15-18,20-21H,11,14H2,1-10H3/b13-12+/t15-,16-,17+,18-,20-,21+/m1/s1 |
| InChIKey | LFJRXHYVWNZDHW-DNHFHQNZSA-N |
| XLogP | 5.77 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.67 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|