C21H36O4Si — CID 117070790
methyl (6S,8aR)-6-[tert-butyl(dimethyl)silyl]oxy-5,5,8a-trimethyl-1-oxo-3,6,7,8-tetrahydro-2H-naphthalene-2-carboxylate (PubChem CID 117070790) has the molecular formula C21H36O4Si and a molecular weight of 380.60 g/mol. Its IUPAC name is methyl (6S,8aR)-6-[tert-butyl(dimethyl)silyl]oxy-5,5,8a-trimethyl-1-oxo-3,6,7,8-tetrahydro-2H-naphthalene-2-carboxylate.
| Compound Name | methyl (6S,8aR)-6-[tert-butyl(dimethyl)silyl]oxy-5,5,8a-trimethyl-1-oxo-3,6,7,8-tetrahydro-2H-naphthalene-2-carboxylate |
|---|---|
| PubChem CID | 117070790 |
| Molecular Formula | C21H36O4Si |
| Molecular Weight | 380.60 g/mol |
| Exact Mass | 380.24 |
| IUPAC Name | methyl (6S,8aR)-6-[tert-butyl(dimethyl)silyl]oxy-5,5,8a-trimethyl-1-oxo-3,6,7,8-tetrahydro-2H-naphthalene-2-carboxylate |
| SMILES | COC(=O)C1CC=C2C(C)(C)[C@@H](O[Si](C)(C)C(C)(C)C)CC[C@@]2(C)C1=O |
| InChI | InChI=1S/C21H36O4Si/c1-19(2,3)26(8,9)25-16-12-13-21(6)15(20(16,4)5)11-10-14(17(21)22)18(23)24-7/h11,14,16H,10,12-13H2,1-9H3/t14?,16-,21+/m0/s1 |
| InChIKey | OWSGLNJXHQYREH-MWMGUDAUSA-N |
| XLogP | 4.89 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.60 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|