C30H50O6Si — CID 11124338
[(1S,3R,7R,8R,8aR)-8-[2-[(2R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-6-oxooxan-2-yl]ethyl]-3,7-dimethyl-6-oxo-2,3,5,7,8,8a-hexahydro-1H-naphthalen-1-yl] (2S)-2-methylbutanoate (PubChem CID 11124338) has the molecular formula C30H50O6Si and a molecular weight of 534.81 g/mol. Its IUPAC name is [(1S,3R,7R,8R,8aR)-8-[2-[(2R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-6-oxooxan-2-yl]ethyl]-3,7-dimethyl-6-oxo-2,3,5,7,8,8a-hexahydro-1H-naphthalen-1-yl] (2S)-2-methylbutanoate.
| Compound Name | [(1S,3R,7R,8R,8aR)-8-[2-[(2R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-6-oxooxan-2-yl]ethyl]-3,7-dimethyl-6-oxo-2,3,5,7,8,8a-hexahydro-1H-naphthalen-1-yl] (2S)-2-methylbutanoate |
|---|---|
| PubChem CID | 11124338 |
| Molecular Formula | C30H50O6Si |
| Molecular Weight | 534.81 g/mol |
| Exact Mass | 534.34 |
| IUPAC Name | [(1S,3R,7R,8R,8aR)-8-[2-[(2R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-6-oxooxan-2-yl]ethyl]-3,7-dimethyl-6-oxo-2,3,5,7,8,8a-hexahydro-1H-naphthalen-1-yl] (2S)-2-methylbutanoate |
| SMILES | CC[C@H](C)C(=O)O[C@H]1C[C@@H](C)C=C2CC(=O)[C@H](C)[C@H](CC[C@@H]3C[C@@H](O[Si](C)(C)C(C)(C)C)CC(=O)O3)[C@H]21 |
| InChI | InChI=1S/C30H50O6Si/c1-10-19(3)29(33)35-26-14-18(2)13-21-15-25(31)20(4)24(28(21)26)12-11-22-16-23(17-27(32)34-22)36-37(8,9)30(5,6)7/h13,18-20,22-24,26,28H,10-12,14-17H2,1-9H3/t18-,19-,20+,22+,23+,24-,26-,28-/m0/s1 |
| InChIKey | KSHPFDWUKDUDJK-WXDURPFQSA-N |
| XLogP | 6.63 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.81 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|