C22H36O4Si — CID 53343871
ethyl (1R,4S,7aS)-1-[tert-butyl(dimethyl)silyl]oxy-4-methyl-5-oxo-7a-prop-2-enyl-1,2,6,7-tetrahydroindene-4-carboxylate (PubChem CID 53343871) has the molecular formula C22H36O4Si and a molecular weight of 392.61 g/mol. Its IUPAC name is ethyl (1R,4S,7aS)-1-[tert-butyl(dimethyl)silyl]oxy-4-methyl-5-oxo-7a-prop-2-enyl-1,2,6,7-tetrahydroindene-4-carboxylate.
| Compound Name | ethyl (1R,4S,7aS)-1-[tert-butyl(dimethyl)silyl]oxy-4-methyl-5-oxo-7a-prop-2-enyl-1,2,6,7-tetrahydroindene-4-carboxylate |
|---|---|
| PubChem CID | 53343871 |
| Molecular Formula | C22H36O4Si |
| Molecular Weight | 392.61 g/mol |
| Exact Mass | 392.24 |
| IUPAC Name | ethyl (1R,4S,7aS)-1-[tert-butyl(dimethyl)silyl]oxy-4-methyl-5-oxo-7a-prop-2-enyl-1,2,6,7-tetrahydroindene-4-carboxylate |
| SMILES | C=CC[C@@]12CCC(=O)[C@@](C)(C(=O)OCC)C1=CC[C@H]2O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H36O4Si/c1-9-14-22-15-13-17(23)21(6,19(24)25-10-2)16(22)11-12-18(22)26-27(7,8)20(3,4)5/h9,11,18H,1,10,12-15H2,2-8H3/t18-,21+,22-/m1/s1 |
| InChIKey | JQZKHCMTPCVXSE-BVYCBKJFSA-N |
| XLogP | 5.20 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.61 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|