C23H23N3O6 — CID 110542475
3-morpholin-4-yl-4-(4-nitrophenyl)-1-(4-propan-2-yloxyphenyl)pyrrole-2,5-dione (PubChem CID 110542475) has the molecular formula C23H23N3O6 and a molecular weight of 437.45 g/mol. Its IUPAC name is 3-morpholin-4-yl-4-(4-nitrophenyl)-1-(4-propan-2-yloxyphenyl)pyrrole-2,5-dione.
| Compound Name | 3-morpholin-4-yl-4-(4-nitrophenyl)-1-(4-propan-2-yloxyphenyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110542475 |
| Molecular Formula | C23H23N3O6 |
| Molecular Weight | 437.45 g/mol |
| Exact Mass | 437.16 |
| IUPAC Name | 3-morpholin-4-yl-4-(4-nitrophenyl)-1-(4-propan-2-yloxyphenyl)pyrrole-2,5-dione |
| SMILES | CC(C)Oc1ccc(N2C(=O)C(c3ccc([N+](=O)[O-])cc3)=C(N3CCOCC3)C2=O)cc1 |
| InChI | InChI=1S/C23H23N3O6/c1-15(2)32-19-9-7-17(8-10-19)25-22(27)20(16-3-5-18(6-4-16)26(29)30)21(23(25)28)24-11-13-31-14-12-24/h3-10,15H,11-14H2,1-2H3 |
| InChIKey | NEIXLTKWKYCVFD-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 102.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.45 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|