C24H17F2N3O4 — CID 110542781
3-[benzyl(methyl)amino]-1-(3,4-difluorophenyl)-4-(4-nitrophenyl)pyrrole-2,5-dione (PubChem CID 110542781) has the molecular formula C24H17F2N3O4 and a molecular weight of 449.41 g/mol. Its IUPAC name is 3-[benzyl(methyl)amino]-1-(3,4-difluorophenyl)-4-(4-nitrophenyl)pyrrole-2,5-dione.
| Compound Name | 3-[benzyl(methyl)amino]-1-(3,4-difluorophenyl)-4-(4-nitrophenyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110542781 |
| Molecular Formula | C24H17F2N3O4 |
| Molecular Weight | 449.41 g/mol |
| Exact Mass | 449.12 |
| IUPAC Name | 3-[benzyl(methyl)amino]-1-(3,4-difluorophenyl)-4-(4-nitrophenyl)pyrrole-2,5-dione |
| SMILES | CN(Cc1ccccc1)C1=C(c2ccc([N+](=O)[O-])cc2)C(=O)N(c2ccc(F)c(F)c2)C1=O |
| InChI | InChI=1S/C24H17F2N3O4/c1-27(14-15-5-3-2-4-6-15)22-21(16-7-9-17(10-8-16)29(32)33)23(30)28(24(22)31)18-11-12-19(25)20(26)13-18/h2-13H,14H2,1H3 |
| InChIKey | NKFFGVODEYDRCI-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 83.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.41 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|