C18H12F2N2O4S — CID 110542789
1-(3,4-difluorophenyl)-3-ethylsulfanyl-4-(4-nitrophenyl)pyrrole-2,5-dione (PubChem CID 110542789) has the molecular formula C18H12F2N2O4S and a molecular weight of 390.37 g/mol. Its IUPAC name is 1-(3,4-difluorophenyl)-3-ethylsulfanyl-4-(4-nitrophenyl)pyrrole-2,5-dione.
| Compound Name | 1-(3,4-difluorophenyl)-3-ethylsulfanyl-4-(4-nitrophenyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110542789 |
| Molecular Formula | C18H12F2N2O4S |
| Molecular Weight | 390.37 g/mol |
| Exact Mass | 390.05 |
| IUPAC Name | 1-(3,4-difluorophenyl)-3-ethylsulfanyl-4-(4-nitrophenyl)pyrrole-2,5-dione |
| SMILES | CCSC1=C(c2ccc([N+](=O)[O-])cc2)C(=O)N(c2ccc(F)c(F)c2)C1=O |
| InChI | InChI=1S/C18H12F2N2O4S/c1-2-27-16-15(10-3-5-11(6-4-10)22(25)26)17(23)21(18(16)24)12-7-8-13(19)14(20)9-12/h3-9H,2H2,1H3 |
| InChIKey | ODVOZVBCGCTSEL-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 80.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.37 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|