C24H22F4N2O2 — CID 110542915
3-(4-fluorophenyl)-4-(4-methylpiperidin-1-yl)-1-[[3-(trifluoromethyl)phenyl]methyl]pyrrole-2,5-dione (PubChem CID 110542915) has the molecular formula C24H22F4N2O2 and a molecular weight of 446.44 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-4-(4-methylpiperidin-1-yl)-1-[[3-(trifluoromethyl)phenyl]methyl]pyrrole-2,5-dione.
| Compound Name | 3-(4-fluorophenyl)-4-(4-methylpiperidin-1-yl)-1-[[3-(trifluoromethyl)phenyl]methyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110542915 |
| Molecular Formula | C24H22F4N2O2 |
| Molecular Weight | 446.44 g/mol |
| Exact Mass | 446.16 |
| IUPAC Name | 3-(4-fluorophenyl)-4-(4-methylpiperidin-1-yl)-1-[[3-(trifluoromethyl)phenyl]methyl]pyrrole-2,5-dione |
| SMILES | CC1CCN(C2=C(c3ccc(F)cc3)C(=O)N(Cc3cccc(C(F)(F)F)c3)C2=O)CC1 |
| InChI | InChI=1S/C24H22F4N2O2/c1-15-9-11-29(12-10-15)21-20(17-5-7-19(25)8-6-17)22(31)30(23(21)32)14-16-3-2-4-18(13-16)24(26,27)28/h2-8,13,15H,9-12,14H2,1H3 |
| InChIKey | NRLPHHIGMQNTPM-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.44 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|