C26H28FN3O3 — CID 110543427
3-(4-fluorophenyl)-4-[4-(3-methylphenyl)piperazin-1-yl]-1-(oxolan-2-ylmethyl)pyrrole-2,5-dione (PubChem CID 110543427) has the molecular formula C26H28FN3O3 and a molecular weight of 449.53 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-4-[4-(3-methylphenyl)piperazin-1-yl]-1-(oxolan-2-ylmethyl)pyrrole-2,5-dione.
| Compound Name | 3-(4-fluorophenyl)-4-[4-(3-methylphenyl)piperazin-1-yl]-1-(oxolan-2-ylmethyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110543427 |
| Molecular Formula | C26H28FN3O3 |
| Molecular Weight | 449.53 g/mol |
| Exact Mass | 449.21 |
| IUPAC Name | 3-(4-fluorophenyl)-4-[4-(3-methylphenyl)piperazin-1-yl]-1-(oxolan-2-ylmethyl)pyrrole-2,5-dione |
| SMILES | Cc1cccc(N2CCN(C3=C(c4ccc(F)cc4)C(=O)N(CC4CCCO4)C3=O)CC2)c1 |
| InChI | InChI=1S/C26H28FN3O3/c1-18-4-2-5-21(16-18)28-11-13-29(14-12-28)24-23(19-7-9-20(27)10-8-19)25(31)30(26(24)32)17-22-6-3-15-33-22/h2,4-5,7-10,16,22H,3,6,11-15,17H2,1H3 |
| InChIKey | CRQLLNHBBDLSES-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.53 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|