C23H30N2O5 — CID 110551013
3-[4-(2-methylpropoxy)phenyl]-4-morpholin-4-yl-1-(oxolan-2-ylmethyl)pyrrole-2,5-dione (PubChem CID 110551013) has the molecular formula C23H30N2O5 and a molecular weight of 414.50 g/mol. Its IUPAC name is 3-[4-(2-methylpropoxy)phenyl]-4-morpholin-4-yl-1-(oxolan-2-ylmethyl)pyrrole-2,5-dione.
| Compound Name | 3-[4-(2-methylpropoxy)phenyl]-4-morpholin-4-yl-1-(oxolan-2-ylmethyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110551013 |
| Molecular Formula | C23H30N2O5 |
| Molecular Weight | 414.50 g/mol |
| Exact Mass | 414.22 |
| IUPAC Name | 3-[4-(2-methylpropoxy)phenyl]-4-morpholin-4-yl-1-(oxolan-2-ylmethyl)pyrrole-2,5-dione |
| SMILES | CC(C)COc1ccc(C2=C(N3CCOCC3)C(=O)N(CC3CCCO3)C2=O)cc1 |
| InChI | InChI=1S/C23H30N2O5/c1-16(2)15-30-18-7-5-17(6-8-18)20-21(24-9-12-28-13-10-24)23(27)25(22(20)26)14-19-4-3-11-29-19/h5-8,16,19H,3-4,9-15H2,1-2H3 |
| InChIKey | HDCMFDZHNRKRNW-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.50 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|